![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| DeepMind AlphaFold 3 - This Will Change Everything! [Mz7Qp73lj9o].mp4 | 2025-02-23 16:03 | 246M | |
| RFDiffusion： Accurate protein design using structure prediction and diffusion generative models [wIHwHDt2NoI].mp4 | 2025-02-23 16:03 | 134M | |
| Protein generation with evolutionary diffusion： sequence is all you need [e1e-_SkyNjw].mp4 | 2025-02-23 16:02 | 117M | |
| AFS-anim-7PNM.mp4 | 2025-02-23 16:03 | 20M | |
| AFS-anim-8AW3.mp4 | 2025-02-23 16:02 | 10M | |
| diffusion_animation_C6_black.gif | 2025-02-23 16:03 | 9.0M | |
| diffusion_animation_PTHbinder.gif | 2025-02-23 16:03 | 6.0M | |
| AFS-anim-7R6R.mp4 | 2025-02-23 16:03 | 5.7M | |
| AF2_3kc-q0RHauZdDm6v.mp4 | 2025-02-23 16:03 | 4.4M | |
| AFS-anim-7BBV.mp4 | 2025-02-23 16:03 | 3.3M | |
| F56KQNzXYAEtMuL.mp4 | 2025-02-23 16:03 | 412K | |
| README.txt | 2025-05-12 18:08 | 2.0K | |